Phosphorus is a nonmetallic chemical element with symbol P and atomic number 15. A multivalent pnictogen, phosphorus as a mineral is almost always present in its maximally oxidised state, as inorganic phosphate rocks. Elemental phosphorus exists in two major forms—white phosphorus and red phosphorus—but due to its high reactivity, phosphorus is never found as a free element on Earth.
There is some compounds containing phosphorus, oxygen (known as oxides), hydrogen (known as hydrides), and some other compounds of phosphorus. For each compound, a formal oxidation number for phosphorus is given, In compounds of phosphorus (where known), the most common oxidation numbers of phosphorus are: 5, 3, and -3.
1. Hydrides
The term hydride is used to indicate compounds of the type MxHy and not necessarily to indicate that any compounds listed behave as hydrides chemically.
Phosphine: PH3
Diphosphorus tetrahydride: P2H4
2. Fluorides
Phosphorus trifluoride: PF3
Phosphorus pentafluoride: PF5
Diphosphorus tetrafluoride: P2F4
3. Chlorides
Phosphorus trichloride: PCl3
Phosphorus pentachloride: PCl5
Diphosphorus tetrachloride: P2Cl4
Phosphorus oxychloride: POCl3
Dichlorvos: (CH3O)2P(O)OCH=CCl2
4. Bromides
Phosphorus pentabromide: PBr5
Diphosphorus tetrabromide: P2Br4
Dimethyl-1,2-dibromo-2,2-dichlorethyl phosphate: (CH3O)2P(O)OCHBrCBrCl2
5. Iodides
Phosphorus triiodide: PI3
Diphosphorus tetraiodide: P2I4
6. Oxides
Tetraphosphorus decaoxide: P4O10
Tetraphosphorus hexaoxide: P4O6
7. Sulfides
Phosphorus pentasulfide: P2S5
Phosphorus pentasulfide: P4S10
Phosphorus Trisulfide: P2S3
Sulprofos: C12H19O2PS3
Azinphos-methyl: C10H12O3PS2N3 [(CH3O)2P(S)SCH2(N3C7H4O)]
Fenthion: C10H15O3PS [(CH3O)2P(S)OC6H3(CH3)SCH3]
Fonofos: C10H15OPS2
Chlorpyrifos: C9H11Cl3NO3PS
Demeton: (C2H5O)2PSOC2H4SC2H5
Dimethyl glycol phthalate: C12H21N2O3PS
Disulfoton: C8H19O2PS3 [(C2H5O)2P(S)S(CH2)2SC2H5]
EPN: C14H14O4NSP [(C2H5O(C6H5)P(S)OC6H4NO2)]
Ethion: [(C2H5O)2P(S)S]2CH2
Ethyl butyrate: [(CH3CH2O)2PS]2O
Ethyl parathion: (C2H5O)2P(S)OC6H4NO2
Fenamiphos: C13H22NO3PS
Fensulfothion: C11H17O4PS2 [(C2H5O)2P(S)OC6H4S(O)CH3]
Malathion: C10H19O6PS2 [(CH3O)2P(S)SCH(COOC2H5)CH2COOC2H5]
Methyl demeton: C6H15O3PS2 [(CH3O)2P(S)O[CH2]2SCH2CH3]
Methyl parathion: (CH3O)2P(S)OC6H4NO2
Phorate: (C2H5O)2P(S)SCH2SC2H5
8. Others
Phosphoric acid: H3PO4
Calcium phosphide: Ca3P2
Dibutyl phosphate: (C4H9O)2(OH)PO
Dicrotophos: C8H16NO5P
Monocrotophos: C7H14NO5P [(CH3O)2P(O)OC(CH3)=CHC(O)NHCH3]
Phenylphosphine: C6H5PH2
Triphenylphosphine: P(C6H5)3
Tetraethyl pyrophosphate: [(CH3CH2O)2PO]2O
Tetrasodium pyrophosphate: Na4P2O7
Tri-Phenyl Phosphate: (C6H5O)3PO
Tributyl phosphate: (CH3[CH2]3O)3PO
Tributyl phosphate: C12H27O4P
Trimethyl phosphite: (CH3O)3P
Triorthocresyl phosphate: (CH3C6H40)3PO
flowerlife1 